About ethyl carbonate;tributyl(methyl)azanium
ethyl carbonate;tributyl(methyl)azanium (PubChem CID 137355967) has the molecular formula C16H35NO3
and a molecular weight of 289.46 g/mol. Its IUPAC name is ethyl carbonate;tributyl(methyl)azanium.
Molecular Properties
| Compound Name | ethyl carbonate;tributyl(methyl)azanium |
| PubChem CID | 137355967 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | ethyl carbonate;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.CCOC(=O)[O-] |
| InChI | InChI=1S/C13H30N.C3H6O3/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-2-6-3(4)5/h5-13H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | WBAXLCSXGQHBHW-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbonate;tributyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbonate;tributyl(methyl)azanium?
The IUPAC name of ethyl carbonate;tributyl(methyl)azanium (CID 137355967) is ethyl carbonate;tributyl(methyl)azanium.
What is the SMILES notation for ethyl carbonate;tributyl(methyl)azanium?
The canonical SMILES for ethyl carbonate;tributyl(methyl)azanium is CCCC[N+](C)(CCCC)CCCC.CCOC(=O)[O-].
What is the InChIKey of ethyl carbonate;tributyl(methyl)azanium?
The InChIKey is WBAXLCSXGQHBHW-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H30N.C3H6O3/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-2-6-3(4)5/h5-13H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of ethyl carbonate;tributyl(methyl)azanium?
ethyl carbonate;tributyl(methyl)azanium has a molecular weight of 289.46 g/mol, XLogP of 3.20, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbonate;tributyl(methyl)azanium is sourced from PubChem (CID 137355967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).