About 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium
2-hydroxy-2-oxoacetate;tributyl(methyl)azanium (PubChem CID 173028371) has the molecular formula C15H31NO4
and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium.
Molecular Properties
| Compound Name | 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium |
| PubChem CID | 173028371 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.O=C([O-])C(=O)O |
| InChI | InChI=1S/C13H30N.C2H2O4/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1(4)2(5)6/h5-13H2,1-4H3;(H,3,4)(H,5,6)/q+1;/p-1 |
| InChIKey | LLNAFOZHXDCKSA-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium?
The IUPAC name of 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium (CID 173028371) is 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium.
What is the SMILES notation for 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium?
The canonical SMILES for 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium is CCCC[N+](C)(CCCC)CCCC.O=C([O-])C(=O)O.
What is the InChIKey of 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium?
The InChIKey is LLNAFOZHXDCKSA-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H30N.C2H2O4/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1(4)2(5)6/h5-13H2,1-4H3;(H,3,4)(H,5,6)/q+1;/p-1.
What are the key properties of 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium?
2-hydroxy-2-oxoacetate;tributyl(methyl)azanium has a molecular weight of 289.42 g/mol, XLogP of 1.65, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-oxoacetate;tributyl(methyl)azanium is sourced from PubChem (CID 173028371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).