About decanedioate;bis(tributyl(methyl)azanium)
decanedioate;bis(tributyl(methyl)azanium) (PubChem CID 141445266) has the molecular formula C36H76N2O4
and a molecular weight of 601.01 g/mol. Its IUPAC name is decanedioate;bis(tributyl(methyl)azanium).
Molecular Properties
| Compound Name | decanedioate;bis(tributyl(methyl)azanium) |
| PubChem CID | 141445266 |
| Molecular Formula | C36H76N2O4 |
| Molecular Weight | 601.01 g/mol |
| Exact Mass | 600.58 |
| IUPAC Name | decanedioate;bis(tributyl(methyl)azanium) |
| SMILES | CCCC[N+](C)(CCCC)CCCC.CCCC[N+](C)(CCCC)CCCC.O=C([O-])CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/2C13H30N.C10H18O4/c2*1-5-8-11-14(4,12-9-6-2)13-10-7-3;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h2*5-13H2,1-4H3;1-8H2,(H,11,12)(H,13,14)/q2*+1;/p-2 |
| InChIKey | MIVCYEYHWSQPRF-UHFFFAOYSA-L |
| XLogP | 7.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.01 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze decanedioate;bis(tributyl(methyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanedioate;bis(tributyl(methyl)azanium)?
The IUPAC name of decanedioate;bis(tributyl(methyl)azanium) (CID 141445266) is decanedioate;bis(tributyl(methyl)azanium).
What is the SMILES notation for decanedioate;bis(tributyl(methyl)azanium)?
The canonical SMILES for decanedioate;bis(tributyl(methyl)azanium) is CCCC[N+](C)(CCCC)CCCC.CCCC[N+](C)(CCCC)CCCC.O=C([O-])CCCCCCCCC(=O)[O-].
What is the InChIKey of decanedioate;bis(tributyl(methyl)azanium)?
The InChIKey is MIVCYEYHWSQPRF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H30N.C10H18O4/c2*1-5-8-11-14(4,12-9-6-2)13-10-7-3;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h2*5-13H2,1-4H3;1-8H2,(H,11,12)(H,13,14)/q2*+1;/p-2.
What are the key properties of decanedioate;bis(tributyl(methyl)azanium)?
decanedioate;bis(tributyl(methyl)azanium) has a molecular weight of 601.01 g/mol, XLogP of 7.27, 27 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decanedioate;bis(tributyl(methyl)azanium) is sourced from PubChem (CID 141445266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).