About methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate
methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate (PubChem CID 118385659) has the molecular formula C40H81NO2
and a molecular weight of 608.09 g/mol. Its IUPAC name is methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate |
| PubChem CID | 118385659 |
| Molecular Formula | C40H81NO2 |
| Molecular Weight | 608.09 g/mol |
| Exact Mass | 607.63 |
| IUPAC Name | methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].CCCCCCCC[N+](C)(CCCCC)CCCCCCCC |
| InChI | InChI=1S/C22H48N.C18H34O2/c1-5-8-11-13-15-18-21-23(4,20-17-10-7-3)22-19-16-14-12-9-6-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-22H2,1-4H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/q+1;/p-1/b;10-9- |
| InChIKey | HZVGNVICRUNGHR-SVMKZPJVSA-M |
| XLogP | 12.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.09 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate?
The IUPAC name of methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate (CID 118385659) is methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate.
What is the SMILES notation for methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate?
The canonical SMILES for methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)[O-].CCCCCCCC[N+](C)(CCCCC)CCCCCCCC.
What is the InChIKey of methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate?
The InChIKey is HZVGNVICRUNGHR-SVMKZPJVSA-M. The full InChI is InChI=1S/C22H48N.C18H34O2/c1-5-8-11-13-15-18-21-23(4,20-17-10-7-3)22-19-16-14-12-9-6-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-22H2,1-4H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/q+1;/p-1/b;10-9-.
What are the key properties of methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate?
methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate has a molecular weight of 608.09 g/mol, XLogP of 12.12, 33 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-dioctyl-pentylazanium;(Z)-octadec-9-enoate is sourced from PubChem (CID 118385659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).