C50H101NO2 — CID 118289722
(Z)-octadec-9-enoate;tetraoctylazanium (PubChem CID 118289722) has the molecular formula C50H101NO2 and a molecular weight of 748.36 g/mol. Its IUPAC name is (Z)-octadec-9-enoate;tetraoctylazanium.
| Compound Name | (Z)-octadec-9-enoate;tetraoctylazanium |
|---|---|
| PubChem CID | 118289722 |
| Molecular Formula | C50H101NO2 |
| Molecular Weight | 748.36 g/mol |
| Exact Mass | 747.78 |
| IUPAC Name | (Z)-octadec-9-enoate;tetraoctylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C32H68N.C18H34O2/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-32H2,1-4H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/q+1;/p-1/b;10-9- |
| InChIKey | SYEKMILKKULOSW-SVMKZPJVSA-M |
| XLogP | 16.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.36 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|