C29H53NO6 — CID 177430559
5-[bis(4-carboxybutyl)-[(E)-tetradec-6-enyl]azaniumyl]pentanoate (PubChem CID 177430559) has the molecular formula C29H53NO6 and a molecular weight of 511.74 g/mol. Its IUPAC name is 5-[bis(4-carboxybutyl)-[(E)-tetradec-6-enyl]azaniumyl]pentanoate.
| Compound Name | 5-[bis(4-carboxybutyl)-[(E)-tetradec-6-enyl]azaniumyl]pentanoate |
|---|---|
| PubChem CID | 177430559 |
| Molecular Formula | C29H53NO6 |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.39 |
| IUPAC Name | 5-[bis(4-carboxybutyl)-[(E)-tetradec-6-enyl]azaniumyl]pentanoate |
| SMILES | CCCCCCC/C=C/CCCCC[N+](CCCCC(=O)[O-])(CCCCC(=O)O)CCCCC(=O)O |
| InChI | InChI=1S/C29H53NO6/c1-2-3-4-5-6-7-8-9-10-11-12-16-23-30(24-17-13-20-27(31)32,25-18-14-21-28(33)34)26-19-15-22-29(35)36/h8-9H,2-7,10-26H2,1H3,(H2-,31,32,33,34,35,36)/b9-8+ |
| InChIKey | MMLFFKAMILQLDS-CMDGGOBGSA-N |
| XLogP | 5.71 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|