C27H49NO6 — CID 177394058
4-[bis(3-carboxypropyl)-[(E)-pentadec-8-enyl]azaniumyl]butanoate (PubChem CID 177394058) has the molecular formula C27H49NO6 and a molecular weight of 483.69 g/mol. Its IUPAC name is 4-[bis(3-carboxypropyl)-[(E)-pentadec-8-enyl]azaniumyl]butanoate.
| Compound Name | 4-[bis(3-carboxypropyl)-[(E)-pentadec-8-enyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 177394058 |
| Molecular Formula | C27H49NO6 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.36 |
| IUPAC Name | 4-[bis(3-carboxypropyl)-[(E)-pentadec-8-enyl]azaniumyl]butanoate |
| SMILES | CCCCCC/C=C/CCCCCCC[N+](CCCC(=O)[O-])(CCCC(=O)O)CCCC(=O)O |
| InChI | InChI=1S/C27H49NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-28(22-15-18-25(29)30,23-16-19-26(31)32)24-17-20-27(33)34/h7-8H,2-6,9-24H2,1H3,(H2-,29,30,31,32,33,34)/b8-7+ |
| InChIKey | UDCFOSHMDOCTRJ-BQYQJAHWSA-N |
| XLogP | 4.93 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|