C22H39NO6 — CID 177404040
4-[bis(3-carboxypropyl)-[(E)-dec-6-enyl]azaniumyl]butanoate (PubChem CID 177404040) has the molecular formula C22H39NO6 and a molecular weight of 413.56 g/mol. Its IUPAC name is 4-[bis(3-carboxypropyl)-[(E)-dec-6-enyl]azaniumyl]butanoate.
| Compound Name | 4-[bis(3-carboxypropyl)-[(E)-dec-6-enyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 177404040 |
| Molecular Formula | C22H39NO6 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 4-[bis(3-carboxypropyl)-[(E)-dec-6-enyl]azaniumyl]butanoate |
| SMILES | CCC/C=C/CCCCC[N+](CCCC(=O)[O-])(CCCC(=O)O)CCCC(=O)O |
| InChI | InChI=1S/C22H39NO6/c1-2-3-4-5-6-7-8-9-16-23(17-10-13-20(24)25,18-11-14-21(26)27)19-12-15-22(28)29/h4-5H,2-3,6-19H2,1H3,(H2-,24,25,26,27,28,29)/b5-4+ |
| InChIKey | NFOXKRWGVVBCGY-SNAWJCMRSA-N |
| XLogP | 2.98 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|