C15H35NO3S — CID 127262895
ethanesulfonate;tributyl(methyl)azanium (PubChem CID 127262895) has the molecular formula C15H35NO3S and a molecular weight of 309.52 g/mol. Its IUPAC name is ethanesulfonate;tributyl(methyl)azanium.
| Compound Name | ethanesulfonate;tributyl(methyl)azanium |
|---|---|
| PubChem CID | 127262895 |
| Molecular Formula | C15H35NO3S |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | ethanesulfonate;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H30N.C2H6O3S/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-2-6(3,4)5/h5-13H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | SBWDEEDTCZJVDG-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|