About 2-aminoethanesulfonate;tributyl(methyl)azanium
2-aminoethanesulfonate;tributyl(methyl)azanium (PubChem CID 127262881) has the molecular formula C15H36N2O3S
and a molecular weight of 324.53 g/mol. Its IUPAC name is 2-aminoethanesulfonate;tributyl(methyl)azanium.
Molecular Properties
| Compound Name | 2-aminoethanesulfonate;tributyl(methyl)azanium |
| PubChem CID | 127262881 |
| Molecular Formula | C15H36N2O3S |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 2-aminoethanesulfonate;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.NCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H30N.C2H7NO3S/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1-2-7(4,5)6/h5-13H2,1-4H3;1-3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | RDPOCARERSGEJW-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanesulfonate;tributyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanesulfonate;tributyl(methyl)azanium?
The IUPAC name of 2-aminoethanesulfonate;tributyl(methyl)azanium (CID 127262881) is 2-aminoethanesulfonate;tributyl(methyl)azanium.
What is the SMILES notation for 2-aminoethanesulfonate;tributyl(methyl)azanium?
The canonical SMILES for 2-aminoethanesulfonate;tributyl(methyl)azanium is CCCC[N+](C)(CCCC)CCCC.NCCS(=O)(=O)[O-].
What is the InChIKey of 2-aminoethanesulfonate;tributyl(methyl)azanium?
The InChIKey is RDPOCARERSGEJW-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H30N.C2H7NO3S/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1-2-7(4,5)6/h5-13H2,1-4H3;1-3H2,(H,4,5,6)/q+1;/p-1.
What are the key properties of 2-aminoethanesulfonate;tributyl(methyl)azanium?
2-aminoethanesulfonate;tributyl(methyl)azanium has a molecular weight of 324.53 g/mol, XLogP of 2.32, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanesulfonate;tributyl(methyl)azanium is sourced from PubChem (CID 127262881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).