About propane-1-sulfonate;trihexyl(methyl)azanium
propane-1-sulfonate;trihexyl(methyl)azanium (PubChem CID 87092948) has the molecular formula C22H49NO3S
and a molecular weight of 407.71 g/mol. Its IUPAC name is propane-1-sulfonate;trihexyl(methyl)azanium.
Molecular Properties
| Compound Name | propane-1-sulfonate;trihexyl(methyl)azanium |
| PubChem CID | 87092948 |
| Molecular Formula | C22H49NO3S |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | propane-1-sulfonate;trihexyl(methyl)azanium |
| SMILES | CCCCCC[N+](C)(CCCCCC)CCCCCC.CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H42N.C3H8O3S/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;1-2-3-7(4,5)6/h5-19H2,1-4H3;2-3H2,1H3,(H,4,5,6)/q+1;/p-1 |
| InChIKey | LDLIOQDIJJQDNM-UHFFFAOYSA-M |
| XLogP | 6.12 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze propane-1-sulfonate;trihexyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1-sulfonate;trihexyl(methyl)azanium?
The IUPAC name of propane-1-sulfonate;trihexyl(methyl)azanium (CID 87092948) is propane-1-sulfonate;trihexyl(methyl)azanium.
What is the SMILES notation for propane-1-sulfonate;trihexyl(methyl)azanium?
The canonical SMILES for propane-1-sulfonate;trihexyl(methyl)azanium is CCCCCC[N+](C)(CCCCCC)CCCCCC.CCCS(=O)(=O)[O-].
What is the InChIKey of propane-1-sulfonate;trihexyl(methyl)azanium?
The InChIKey is LDLIOQDIJJQDNM-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H42N.C3H8O3S/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;1-2-3-7(4,5)6/h5-19H2,1-4H3;2-3H2,1H3,(H,4,5,6)/q+1;/p-1.
What are the key properties of propane-1-sulfonate;trihexyl(methyl)azanium?
propane-1-sulfonate;trihexyl(methyl)azanium has a molecular weight of 407.71 g/mol, XLogP of 6.12, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1-sulfonate;trihexyl(methyl)azanium is sourced from PubChem (CID 87092948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).