About decyl(trimethyl)azanium;octane-1-sulfonate
decyl(trimethyl)azanium;octane-1-sulfonate (PubChem CID 159252289) has the molecular formula C21H47NO3S
and a molecular weight of 393.68 g/mol. Its IUPAC name is decyl(trimethyl)azanium;octane-1-sulfonate.
Molecular Properties
| Compound Name | decyl(trimethyl)azanium;octane-1-sulfonate |
| PubChem CID | 159252289 |
| Molecular Formula | C21H47NO3S |
| Molecular Weight | 393.68 g/mol |
| Exact Mass | 393.33 |
| IUPAC Name | decyl(trimethyl)azanium;octane-1-sulfonate |
| SMILES | CCCCCCCCCC[N+](C)(C)C.CCCCCCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H30N.C8H18O3S/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;1-2-3-4-5-6-7-8-12(9,10)11/h5-13H2,1-4H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | KVLIRAWWVMNRFX-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze decyl(trimethyl)azanium;octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl(trimethyl)azanium;octane-1-sulfonate?
The IUPAC name of decyl(trimethyl)azanium;octane-1-sulfonate (CID 159252289) is decyl(trimethyl)azanium;octane-1-sulfonate.
What is the SMILES notation for decyl(trimethyl)azanium;octane-1-sulfonate?
The canonical SMILES for decyl(trimethyl)azanium;octane-1-sulfonate is CCCCCCCCCC[N+](C)(C)C.CCCCCCCCS(=O)(=O)[O-].
What is the InChIKey of decyl(trimethyl)azanium;octane-1-sulfonate?
The InChIKey is KVLIRAWWVMNRFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H30N.C8H18O3S/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;1-2-3-4-5-6-7-8-12(9,10)11/h5-13H2,1-4H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1.
What are the key properties of decyl(trimethyl)azanium;octane-1-sulfonate?
decyl(trimethyl)azanium;octane-1-sulfonate has a molecular weight of 393.68 g/mol, XLogP of 5.73, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decyl(trimethyl)azanium;octane-1-sulfonate is sourced from PubChem (CID 159252289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).