About bis(2-aminoethanesulfonate);dioctyltin(2+)
bis(2-aminoethanesulfonate);dioctyltin(2+) (PubChem CID 175974039) has the molecular formula C20H46N2O6S2Sn
and a molecular weight of 593.44 g/mol. Its IUPAC name is bis(2-aminoethanesulfonate);dioctyltin(2+).
Molecular Properties
| Compound Name | bis(2-aminoethanesulfonate);dioctyltin(2+) |
| PubChem CID | 175974039 |
| Molecular Formula | C20H46N2O6S2Sn |
| Molecular Weight | 593.44 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | bis(2-aminoethanesulfonate);dioctyltin(2+) |
| SMILES | CCCCCCCC[Sn+2]CCCCCCCC.NCCS(=O)(=O)[O-].NCCS(=O)(=O)[O-] |
| InChI | InChI=1S/2C8H17.2C2H7NO3S.Sn/c2*1-3-5-7-8-6-4-2;2*3-1-2-7(4,5)6;/h2*1,3-8H2,2H3;2*1-3H2,(H,4,5,6);/q;;;;+2/p-2 |
| InChIKey | QKLWVEJFGRGVOO-UHFFFAOYSA-L |
| XLogP | 3.23 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 593.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-aminoethanesulfonate);dioctyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminoethanesulfonate);dioctyltin(2+)?
The IUPAC name of bis(2-aminoethanesulfonate);dioctyltin(2+) (CID 175974039) is bis(2-aminoethanesulfonate);dioctyltin(2+).
What is the SMILES notation for bis(2-aminoethanesulfonate);dioctyltin(2+)?
The canonical SMILES for bis(2-aminoethanesulfonate);dioctyltin(2+) is CCCCCCCC[Sn+2]CCCCCCCC.NCCS(=O)(=O)[O-].NCCS(=O)(=O)[O-].
What is the InChIKey of bis(2-aminoethanesulfonate);dioctyltin(2+)?
The InChIKey is QKLWVEJFGRGVOO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H17.2C2H7NO3S.Sn/c2*1-3-5-7-8-6-4-2;2*3-1-2-7(4,5)6;/h2*1,3-8H2,2H3;2*1-3H2,(H,4,5,6);/q;;;;+2/p-2.
What are the key properties of bis(2-aminoethanesulfonate);dioctyltin(2+)?
bis(2-aminoethanesulfonate);dioctyltin(2+) has a molecular weight of 593.44 g/mol, XLogP of 3.23, 18 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminoethanesulfonate);dioctyltin(2+) is sourced from PubChem (CID 175974039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).