About dioctyltin(2+) sulfate
dioctyltin(2+) sulfate (PubChem CID 160759291) has the molecular formula C16H34O4SSn
and a molecular weight of 441.22 g/mol. Its IUPAC name is dioctyltin(2+) sulfate.
Molecular Properties
| Compound Name | dioctyltin(2+) sulfate |
| PubChem CID | 160759291 |
| Molecular Formula | C16H34O4SSn |
| Molecular Weight | 441.22 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | dioctyltin(2+) sulfate |
| SMILES | CCCCCCCC[Sn+2]CCCCCCCC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C8H17.H2O4S.Sn/c2*1-3-5-7-8-6-4-2;1-5(2,3)4;/h2*1,3-8H2,2H3;(H2,1,2,3,4);/q;;;+2/p-2 |
| InChIKey | RXVPLCKJAVLATD-UHFFFAOYSA-L |
| XLogP | 4.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dioctyltin(2+) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyltin(2+) sulfate?
The IUPAC name of dioctyltin(2+) sulfate (CID 160759291) is dioctyltin(2+) sulfate.
What is the SMILES notation for dioctyltin(2+) sulfate?
The canonical SMILES for dioctyltin(2+) sulfate is CCCCCCCC[Sn+2]CCCCCCCC.O=S(=O)([O-])[O-].
What is the InChIKey of dioctyltin(2+) sulfate?
The InChIKey is RXVPLCKJAVLATD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H17.H2O4S.Sn/c2*1-3-5-7-8-6-4-2;1-5(2,3)4;/h2*1,3-8H2,2H3;(H2,1,2,3,4);/q;;;+2/p-2.
What are the key properties of dioctyltin(2+) sulfate?
dioctyltin(2+) sulfate has a molecular weight of 441.22 g/mol, XLogP of 4.91, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyltin(2+) sulfate is sourced from PubChem (CID 160759291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).