About diheptyltin(2+) dichloride
diheptyltin(2+) dichloride (PubChem CID 21324912) has the molecular formula C14H30Cl2Sn
and a molecular weight of 388.01 g/mol. Its IUPAC name is diheptyltin(2+) dichloride.
Molecular Properties
| Compound Name | diheptyltin(2+) dichloride |
| PubChem CID | 21324912 |
| Molecular Formula | C14H30Cl2Sn |
| Molecular Weight | 388.01 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | diheptyltin(2+) dichloride |
| SMILES | CCCCCCC[Sn+2]CCCCCCC.[Cl-].[Cl-] |
| InChI | InChI=1S/2C7H15.2ClH.Sn/c2*1-3-5-7-6-4-2;;;/h2*1,3-7H2,2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | IPTFHACHRGARHN-UHFFFAOYSA-L |
| XLogP | -0.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.01 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diheptyltin(2+) dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diheptyltin(2+) dichloride?
The IUPAC name of diheptyltin(2+) dichloride (CID 21324912) is diheptyltin(2+) dichloride.
What is the SMILES notation for diheptyltin(2+) dichloride?
The canonical SMILES for diheptyltin(2+) dichloride is CCCCCCC[Sn+2]CCCCCCC.[Cl-].[Cl-].
What is the InChIKey of diheptyltin(2+) dichloride?
The InChIKey is IPTFHACHRGARHN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H15.2ClH.Sn/c2*1-3-5-7-6-4-2;;;/h2*1,3-7H2,2H3;2*1H;/q;;;;+2/p-2.
What are the key properties of diheptyltin(2+) dichloride?
diheptyltin(2+) dichloride has a molecular weight of 388.01 g/mol, XLogP of -0.52, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diheptyltin(2+) dichloride is sourced from PubChem (CID 21324912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).