About dioctyltin(2+);bis(octane-1-thiolate)
dioctyltin(2+);bis(octane-1-thiolate) (PubChem CID 23177277) has the molecular formula C32H68S2Sn
and a molecular weight of 635.74 g/mol. Its IUPAC name is dioctyltin(2+);bis(octane-1-thiolate).
Molecular Properties
| Compound Name | dioctyltin(2+);bis(octane-1-thiolate) |
| PubChem CID | 23177277 |
| Molecular Formula | C32H68S2Sn |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 636.38 |
| IUPAC Name | dioctyltin(2+);bis(octane-1-thiolate) |
| SMILES | CCCCCCCC[S-].CCCCCCCC[S-].CCCCCCCC[Sn+2]CCCCCCCC |
| InChI | InChI=1S/2C8H18S.2C8H17.Sn/c2*1-2-3-4-5-6-7-8-9;2*1-3-5-7-8-6-4-2;/h2*9H,2-8H2,1H3;2*1,3-8H2,2H3;/q;;;;+2/p-2 |
| InChIKey | PTTFCYCGVWPSNW-UHFFFAOYSA-L |
| XLogP | 12.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dioctyltin(2+);bis(octane-1-thiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyltin(2+);bis(octane-1-thiolate)?
The IUPAC name of dioctyltin(2+);bis(octane-1-thiolate) (CID 23177277) is dioctyltin(2+);bis(octane-1-thiolate).
What is the SMILES notation for dioctyltin(2+);bis(octane-1-thiolate)?
The canonical SMILES for dioctyltin(2+);bis(octane-1-thiolate) is CCCCCCCC[S-].CCCCCCCC[S-].CCCCCCCC[Sn+2]CCCCCCCC.
What is the InChIKey of dioctyltin(2+);bis(octane-1-thiolate)?
The InChIKey is PTTFCYCGVWPSNW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H18S.2C8H17.Sn/c2*1-2-3-4-5-6-7-8-9;2*1-3-5-7-8-6-4-2;/h2*9H,2-8H2,1H3;2*1,3-8H2,2H3;/q;;;;+2/p-2.
What are the key properties of dioctyltin(2+);bis(octane-1-thiolate)?
dioctyltin(2+);bis(octane-1-thiolate) has a molecular weight of 635.74 g/mol, XLogP of 12.04, 26 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyltin(2+);bis(octane-1-thiolate) is sourced from PubChem (CID 23177277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).