About bis(decane-1-thiolate);dimethyltin(2+)
bis(decane-1-thiolate);dimethyltin(2+) (PubChem CID 21453567) has the molecular formula C22H48S2Sn
and a molecular weight of 495.47 g/mol. Its IUPAC name is bis(decane-1-thiolate);dimethyltin(2+).
Molecular Properties
| Compound Name | bis(decane-1-thiolate);dimethyltin(2+) |
| PubChem CID | 21453567 |
| Molecular Formula | C22H48S2Sn |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | bis(decane-1-thiolate);dimethyltin(2+) |
| SMILES | CCCCCCCCCC[S-].CCCCCCCCCC[S-].C[Sn+2]C |
| InChI | InChI=1S/2C10H22S.2CH3.Sn/c2*1-2-3-4-5-6-7-8-9-10-11;;;/h2*11H,2-10H2,1H3;2*1H3;/q;;;;+2/p-2 |
| InChIKey | CNFDPCHTBTZXFD-UHFFFAOYSA-L |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(decane-1-thiolate);dimethyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(decane-1-thiolate);dimethyltin(2+)?
The IUPAC name of bis(decane-1-thiolate);dimethyltin(2+) (CID 21453567) is bis(decane-1-thiolate);dimethyltin(2+).
What is the SMILES notation for bis(decane-1-thiolate);dimethyltin(2+)?
The canonical SMILES for bis(decane-1-thiolate);dimethyltin(2+) is CCCCCCCCCC[S-].CCCCCCCCCC[S-].C[Sn+2]C.
What is the InChIKey of bis(decane-1-thiolate);dimethyltin(2+)?
The InChIKey is CNFDPCHTBTZXFD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H22S.2CH3.Sn/c2*1-2-3-4-5-6-7-8-9-10-11;;;/h2*11H,2-10H2,1H3;2*1H3;/q;;;;+2/p-2.
What are the key properties of bis(decane-1-thiolate);dimethyltin(2+)?
bis(decane-1-thiolate);dimethyltin(2+) has a molecular weight of 495.47 g/mol, XLogP of 8.13, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(decane-1-thiolate);dimethyltin(2+) is sourced from PubChem (CID 21453567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).