About manganese(2+);bis(octane-1-thiolate)
manganese(2+);bis(octane-1-thiolate) (PubChem CID 88657665) has the molecular formula C16H34MnS2
and a molecular weight of 345.52 g/mol. Its IUPAC name is manganese(2+);bis(octane-1-thiolate).
Molecular Properties
| Compound Name | manganese(2+);bis(octane-1-thiolate) |
| PubChem CID | 88657665 |
| Molecular Formula | C16H34MnS2 |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | manganese(2+);bis(octane-1-thiolate) |
| SMILES | CCCCCCCC[S-].CCCCCCCC[S-].[Mn+2] |
| InChI | InChI=1S/2C8H18S.Mn/c2*1-2-3-4-5-6-7-8-9;/h2*9H,2-8H2,1H3;/q;;+2/p-2 |
| InChIKey | CRYDINXTMYXHMC-UHFFFAOYSA-L |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis(octane-1-thiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(octane-1-thiolate)?
The IUPAC name of manganese(2+);bis(octane-1-thiolate) (CID 88657665) is manganese(2+);bis(octane-1-thiolate).
What is the SMILES notation for manganese(2+);bis(octane-1-thiolate)?
The canonical SMILES for manganese(2+);bis(octane-1-thiolate) is CCCCCCCC[S-].CCCCCCCC[S-].[Mn+2].
What is the InChIKey of manganese(2+);bis(octane-1-thiolate)?
The InChIKey is CRYDINXTMYXHMC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H18S.Mn/c2*1-2-3-4-5-6-7-8-9;/h2*9H,2-8H2,1H3;/q;;+2/p-2.
What are the key properties of manganese(2+);bis(octane-1-thiolate)?
manganese(2+);bis(octane-1-thiolate) has a molecular weight of 345.52 g/mol, XLogP of 5.79, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(octane-1-thiolate) is sourced from PubChem (CID 88657665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).