About zinc;octan-1-ol;sulfate
zinc;octan-1-ol;sulfate (PubChem CID 174737582) has the molecular formula C8H18O5SZn
and a molecular weight of 291.68 g/mol. Its IUPAC name is zinc;octan-1-ol;sulfate.
Molecular Properties
| Compound Name | zinc;octan-1-ol;sulfate |
| PubChem CID | 174737582 |
| Molecular Formula | C8H18O5SZn |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | zinc;octan-1-ol;sulfate |
| SMILES | CCCCCCCCO.O=S(=O)([O-])[O-].[Zn+2] |
| InChI | InChI=1S/C8H18O.H2O4S.Zn/c1-2-3-4-5-6-7-8-9;1-5(2,3)4;/h9H,2-8H2,1H3;(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | XHFUQEKSNLTXMO-UHFFFAOYSA-L |
| XLogP | 1.00 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze zinc;octan-1-ol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;octan-1-ol;sulfate?
The IUPAC name of zinc;octan-1-ol;sulfate (CID 174737582) is zinc;octan-1-ol;sulfate.
What is the SMILES notation for zinc;octan-1-ol;sulfate?
The canonical SMILES for zinc;octan-1-ol;sulfate is CCCCCCCCO.O=S(=O)([O-])[O-].[Zn+2].
What is the InChIKey of zinc;octan-1-ol;sulfate?
The InChIKey is XHFUQEKSNLTXMO-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H18O.H2O4S.Zn/c1-2-3-4-5-6-7-8-9;1-5(2,3)4;/h9H,2-8H2,1H3;(H2,1,2,3,4);/q;;+2/p-2.
What are the key properties of zinc;octan-1-ol;sulfate?
zinc;octan-1-ol;sulfate has a molecular weight of 291.68 g/mol, XLogP of 1.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;octan-1-ol;sulfate is sourced from PubChem (CID 174737582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).