About hexylazanium;sulfate
hexylazanium;sulfate (PubChem CID 88757421) has the molecular formula C12H32N2O4S
and a molecular weight of 300.46 g/mol. Its IUPAC name is hexylazanium;sulfate.
Molecular Properties
| Compound Name | hexylazanium;sulfate |
| PubChem CID | 88757421 |
| Molecular Formula | C12H32N2O4S |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | hexylazanium;sulfate |
| SMILES | CCCCCC[NH3+].CCCCCC[NH3+].O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C6H15N.H2O4S/c2*1-2-3-4-5-6-7;1-5(2,3)4/h2*2-7H2,1H3;(H2,1,2,3,4) |
| InChIKey | FXJGQIRQFOUSMZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hexylazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexylazanium;sulfate?
The IUPAC name of hexylazanium;sulfate (CID 88757421) is hexylazanium;sulfate.
What is the SMILES notation for hexylazanium;sulfate?
The canonical SMILES for hexylazanium;sulfate is CCCCCC[NH3+].CCCCCC[NH3+].O=S(=O)([O-])[O-].
What is the InChIKey of hexylazanium;sulfate?
The InChIKey is FXJGQIRQFOUSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15N.H2O4S/c2*1-2-3-4-5-6-7;1-5(2,3)4/h2*2-7H2,1H3;(H2,1,2,3,4).
What are the key properties of hexylazanium;sulfate?
hexylazanium;sulfate has a molecular weight of 300.46 g/mol, XLogP of 0.28, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexylazanium;sulfate is sourced from PubChem (CID 88757421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).