About 5-azaniumylpentylazanium sulfate
5-azaniumylpentylazanium sulfate (PubChem CID 159934938) has the molecular formula C5H16N2O4S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 5-azaniumylpentylazanium sulfate.
Molecular Properties
| Compound Name | 5-azaniumylpentylazanium sulfate |
| PubChem CID | 159934938 |
| Molecular Formula | C5H16N2O4S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-azaniumylpentylazanium sulfate |
| SMILES | O=S(=O)([O-])[O-].[NH3+]CCCCC[NH3+] |
| InChI | InChI=1S/C5H14N2.H2O4S/c6-4-2-1-3-5-7;1-5(2,3)4/h1-7H2;(H2,1,2,3,4) |
| InChIKey | OACUNRCVXCMTJN-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 5-azaniumylpentylazanium sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azaniumylpentylazanium sulfate?
The IUPAC name of 5-azaniumylpentylazanium sulfate (CID 159934938) is 5-azaniumylpentylazanium sulfate.
What is the SMILES notation for 5-azaniumylpentylazanium sulfate?
The canonical SMILES for 5-azaniumylpentylazanium sulfate is O=S(=O)([O-])[O-].[NH3+]CCCCC[NH3+].
What is the InChIKey of 5-azaniumylpentylazanium sulfate?
The InChIKey is OACUNRCVXCMTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2.H2O4S/c6-4-2-1-3-5-7;1-5(2,3)4/h1-7H2;(H2,1,2,3,4).
What are the key properties of 5-azaniumylpentylazanium sulfate?
5-azaniumylpentylazanium sulfate has a molecular weight of 200.26 g/mol, XLogP of -2.70, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azaniumylpentylazanium sulfate is sourced from PubChem (CID 159934938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).