About hydroxymethylazanium;sulfate
hydroxymethylazanium;sulfate (PubChem CID 161009547) has the molecular formula C2H12N2O6S
and a molecular weight of 192.19 g/mol. Its IUPAC name is hydroxymethylazanium;sulfate.
Molecular Properties
| Compound Name | hydroxymethylazanium;sulfate |
| PubChem CID | 161009547 |
| Molecular Formula | C2H12N2O6S |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | hydroxymethylazanium;sulfate |
| SMILES | O=S(=O)([O-])[O-].[NH3+]CO.[NH3+]CO |
| InChI | InChI=1S/2CH5NO.H2O4S/c2*2-1-3;1-5(2,3)4/h2*3H,1-2H2;(H2,1,2,3,4) |
| InChIKey | YJUULABNCRYFGP-UHFFFAOYSA-N |
| XLogP | -4.98 |
| TPSA | 176.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | -4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethylazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethylazanium;sulfate?
The IUPAC name of hydroxymethylazanium;sulfate (CID 161009547) is hydroxymethylazanium;sulfate.
What is the SMILES notation for hydroxymethylazanium;sulfate?
The canonical SMILES for hydroxymethylazanium;sulfate is O=S(=O)([O-])[O-].[NH3+]CO.[NH3+]CO.
What is the InChIKey of hydroxymethylazanium;sulfate?
The InChIKey is YJUULABNCRYFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH5NO.H2O4S/c2*2-1-3;1-5(2,3)4/h2*3H,1-2H2;(H2,1,2,3,4).
What are the key properties of hydroxymethylazanium;sulfate?
hydroxymethylazanium;sulfate has a molecular weight of 192.19 g/mol, XLogP of -4.98, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethylazanium;sulfate is sourced from PubChem (CID 161009547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).