About azanium;hydroxyazanium;sulfate
azanium;hydroxyazanium;sulfate (PubChem CID 23041852) has the molecular formula H8N2O5S
and a molecular weight of 148.14 g/mol. Its IUPAC name is azanium;hydroxyazanium;sulfate.
Molecular Properties
| Compound Name | azanium;hydroxyazanium;sulfate |
| PubChem CID | 23041852 |
| Molecular Formula | H8N2O5S |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | azanium;hydroxyazanium;sulfate |
| SMILES | O=S(=O)([O-])[O-].[NH3+]O.[NH4+] |
| InChI | InChI=1S/H4NO.H3N.H2O4S/c1-2;;1-5(2,3)4/h2H,1H3;1H3;(H2,1,2,3,4)/q+1;;/p-1 |
| InChIKey | VRTBIZHGOJMOED-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze azanium;hydroxyazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;hydroxyazanium;sulfate?
The IUPAC name of azanium;hydroxyazanium;sulfate (CID 23041852) is azanium;hydroxyazanium;sulfate.
What is the SMILES notation for azanium;hydroxyazanium;sulfate?
The canonical SMILES for azanium;hydroxyazanium;sulfate is O=S(=O)([O-])[O-].[NH3+]O.[NH4+].
What is the InChIKey of azanium;hydroxyazanium;sulfate?
The InChIKey is VRTBIZHGOJMOED-UHFFFAOYSA-M. The full InChI is InChI=1S/H4NO.H3N.H2O4S/c1-2;;1-5(2,3)4/h2H,1H3;1H3;(H2,1,2,3,4)/q+1;;/p-1.
What are the key properties of azanium;hydroxyazanium;sulfate?
azanium;hydroxyazanium;sulfate has a molecular weight of 148.14 g/mol, XLogP of -2.34, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;hydroxyazanium;sulfate is sourced from PubChem (CID 23041852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).