About diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate
diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate (PubChem CID 167445572) has the molecular formula C11H25NO4
and a molecular weight of 235.32 g/mol. Its IUPAC name is diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate.
Molecular Properties
| Compound Name | diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate |
| PubChem CID | 167445572 |
| Molecular Formula | C11H25NO4 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate |
| SMILES | CCOC(=O)[O-].CC[N+](C)(CC)CCOC |
| InChI | InChI=1S/C8H20NO.C3H6O3/c1-5-9(3,6-2)7-8-10-4;1-2-6-3(4)5/h5-8H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | YFKSOMIVEAKKNV-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate?
The IUPAC name of diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate (CID 167445572) is diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate.
What is the SMILES notation for diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate?
The canonical SMILES for diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate is CCOC(=O)[O-].CC[N+](C)(CC)CCOC.
What is the InChIKey of diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate?
The InChIKey is YFKSOMIVEAKKNV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20NO.C3H6O3/c1-5-9(3,6-2)7-8-10-4;1-2-6-3(4)5/h5-8H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate?
diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate has a molecular weight of 235.32 g/mol, XLogP of 0.49, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-(2-methoxyethyl)-methylazanium;ethyl carbonate is sourced from PubChem (CID 167445572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).