C15H33NO5 — CID 118645363
diethyl-(2-methoxyethyl)-methylazanium;3-(2-ethoxyethoxy)propanoate (PubChem CID 118645363) has the molecular formula C15H33NO5 and a molecular weight of 307.43 g/mol. Its IUPAC name is diethyl-(2-methoxyethyl)-methylazanium;3-(2-ethoxyethoxy)propanoate.
| Compound Name | diethyl-(2-methoxyethyl)-methylazanium;3-(2-ethoxyethoxy)propanoate |
|---|---|
| PubChem CID | 118645363 |
| Molecular Formula | C15H33NO5 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | diethyl-(2-methoxyethyl)-methylazanium;3-(2-ethoxyethoxy)propanoate |
| SMILES | CCOCCOCCC(=O)[O-].CC[N+](C)(CC)CCOC |
| InChI | InChI=1S/C8H20NO.C7H14O4/c1-5-9(3,6-2)7-8-10-4;1-2-10-5-6-11-4-3-7(8)9/h5-8H2,1-4H3;2-6H2,1H3,(H,8,9)/q+1;/p-1 |
| InChIKey | HMIYWDTYTFULSR-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|