C16H35NO7 — CID 118645294
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;2-methoxyethyl(trimethyl)azanium (PubChem CID 118645294) has the molecular formula C16H35NO7 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;2-methoxyethyl(trimethyl)azanium.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;2-methoxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 118645294 |
| Molecular Formula | C16H35NO7 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate;2-methoxyethyl(trimethyl)azanium |
| SMILES | COCCOCCOCCOCCC(=O)[O-].COCC[N+](C)(C)C |
| InChI | InChI=1S/C10H20O6.C6H16NO/c1-13-4-5-15-8-9-16-7-6-14-3-2-10(11)12;1-7(2,3)5-6-8-4/h2-9H2,1H3,(H,11,12);5-6H2,1-4H3/q;+1/p-1 |
| InChIKey | LCCQNQBDSJXFRE-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|