C11H25NO6 — CID 171569271
hydrogen carbonate;2-(2-methoxyethoxy)ethyl-(2-methoxyethyl)-dimethylazanium (PubChem CID 171569271) has the molecular formula C11H25NO6 and a molecular weight of 267.32 g/mol. Its IUPAC name is hydrogen carbonate;2-(2-methoxyethoxy)ethyl-(2-methoxyethyl)-dimethylazanium.
| Compound Name | hydrogen carbonate;2-(2-methoxyethoxy)ethyl-(2-methoxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 171569271 |
| Molecular Formula | C11H25NO6 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | hydrogen carbonate;2-(2-methoxyethoxy)ethyl-(2-methoxyethyl)-dimethylazanium |
| SMILES | COCCOCC[N+](C)(C)CCOC.O=C([O-])O |
| InChI | InChI=1S/C10H24NO3.CH2O3/c1-11(2,5-7-12-3)6-8-14-10-9-13-4;2-1(3)4/h5-10H2,1-4H3;(H2,2,3,4)/q+1;/p-1 |
| InChIKey | SVFUODLNNLJNHZ-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|