C18H32ClNO14 — CID 158209152
bis[2-[2-(2-carboxyoxyethoxycarbonyloxy)ethoxy]ethyl]-dimethylazanium chloride (PubChem CID 158209152) has the molecular formula C18H32ClNO14 and a molecular weight of 521.90 g/mol. Its IUPAC name is bis[2-[2-(2-carboxyoxyethoxycarbonyloxy)ethoxy]ethyl]-dimethylazanium chloride.
| Compound Name | bis[2-[2-(2-carboxyoxyethoxycarbonyloxy)ethoxy]ethyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 158209152 |
| Molecular Formula | C18H32ClNO14 |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | bis[2-[2-(2-carboxyoxyethoxycarbonyloxy)ethoxy]ethyl]-dimethylazanium chloride |
| SMILES | C[N+](C)(CCOCCOC(=O)OCCOC(=O)O)CCOCCOC(=O)OCCOC(=O)O.[Cl-] |
| InChI | InChI=1S/C18H31NO14.ClH/c1-19(2,3-5-26-7-9-30-17(24)32-13-11-28-15(20)21)4-6-27-8-10-31-18(25)33-14-12-29-16(22)23;/h3-14H2,1-2H3,(H-,20,21,22,23);1H |
| InChIKey | GNWSVFGLZIINLQ-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|