About 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate
2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate (PubChem CID 87661731) has the molecular formula C9H14O7
and a molecular weight of 234.20 g/mol. Its IUPAC name is 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate |
| PubChem CID | 87661731 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OCCOCCOC(=O)O |
| InChI | InChI=1S/C9H14O7/c1-2-3-15-9(12)16-7-5-13-4-6-14-8(10)11/h2H,1,3-7H2,(H,10,11) |
| InChIKey | RHCZFANKGHOVAS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate?
The IUPAC name of 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate (CID 87661731) is 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate.
What is the SMILES notation for 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate?
The canonical SMILES for 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate is C=CCOC(=O)OCCOCCOC(=O)O.
What is the InChIKey of 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate?
The InChIKey is RHCZFANKGHOVAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O7/c1-2-3-15-9(12)16-7-5-13-4-6-14-8(10)11/h2H,1,3-7H2,(H,10,11).
What are the key properties of 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate?
2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate has a molecular weight of 234.20 g/mol, XLogP of 1.04, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-carboxyoxyethoxy)ethyl prop-2-enyl carbonate is sourced from PubChem (CID 87661731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).