About carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene
carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene (PubChem CID 88663194) has the molecular formula C10H18O8
and a molecular weight of 266.25 g/mol. Its IUPAC name is carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene.
Molecular Properties
| Compound Name | carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene |
| PubChem CID | 88663194 |
| Molecular Formula | C10H18O8 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene |
| SMILES | C=CCOCCOCC=C.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C8H14O2.2CH2O3/c1-3-5-9-7-8-10-6-4-2;2*2-1(3)4/h3-4H,1-2,5-8H2;2*(H2,2,3,4) |
| InChIKey | XHTJFJKJOLOBNV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene?
The IUPAC name of carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene (CID 88663194) is carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene.
What is the SMILES notation for carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene?
The canonical SMILES for carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene is C=CCOCCOCC=C.O=C(O)O.O=C(O)O.
What is the InChIKey of carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene?
The InChIKey is XHTJFJKJOLOBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.2CH2O3/c1-3-5-9-7-8-10-6-4-2;2*2-1(3)4/h3-4H,1-2,5-8H2;2*(H2,2,3,4).
What are the key properties of carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene?
carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene has a molecular weight of 266.25 g/mol, XLogP of 1.84, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;3-(2-prop-2-enoxyethoxy)prop-1-ene is sourced from PubChem (CID 88663194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).