C8H14O4 — CID 59615985
3-(2-prop-2-enoxyethoxy)propanoic acid (PubChem CID 59615985) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-(2-prop-2-enoxyethoxy)propanoic acid.
| Compound Name | 3-(2-prop-2-enoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 59615985 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-(2-prop-2-enoxyethoxy)propanoic acid |
| SMILES | C=CCOCCOCCC(=O)O |
| InChI | InChI=1S/C8H14O4/c1-2-4-11-6-7-12-5-3-8(9)10/h2H,1,3-7H2,(H,9,10) |
| InChIKey | DAYGNAZGJAYJCF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|