C11H20O7 — CID 75202538
4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]butanoic acid (PubChem CID 75202538) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]butanoic acid.
| Compound Name | 4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 75202538 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]butanoic acid |
| SMILES | O=C(O)CCCOCCOCCOCCC(=O)O |
| InChI | InChI=1S/C11H20O7/c12-10(13)2-1-4-16-6-8-18-9-7-17-5-3-11(14)15/h1-9H2,(H,12,13)(H,14,15) |
| InChIKey | KDNPOPNFKGSIOG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|