C7H13IO4 — CID 137354402
3-[2-(2-iodoethoxy)ethoxy]propanoic acid (PubChem CID 137354402) has the molecular formula C7H13IO4 and a molecular weight of 288.08 g/mol. Its IUPAC name is 3-[2-(2-iodoethoxy)ethoxy]propanoic acid.
| Compound Name | 3-[2-(2-iodoethoxy)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 137354402 |
| Molecular Formula | C7H13IO4 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3-[2-(2-iodoethoxy)ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCI |
| InChI | InChI=1S/C7H13IO4/c8-2-4-12-6-5-11-3-1-7(9)10/h1-6H2,(H,9,10) |
| InChIKey | BURHAZLANYBZOZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|