C5H11NO5 — CID 174249816
3-(2-aminoperoxyethoxy)propanoic acid (PubChem CID 174249816) has the molecular formula C5H11NO5 and a molecular weight of 165.14 g/mol. Its IUPAC name is 3-(2-aminoperoxyethoxy)propanoic acid.
| Compound Name | 3-(2-aminoperoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 174249816 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3-(2-aminoperoxyethoxy)propanoic acid |
| SMILES | NOOCCOCCC(=O)O |
| InChI | InChI=1S/C5H11NO5/c6-11-10-4-3-9-2-1-5(7)8/h1-4,6H2,(H,7,8) |
| InChIKey | OLBFAAMCIORJHF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|