C7H17N3O4 — CID 122463166
3-[2-[2-(diaminoamino)ethoxy]ethoxy]propanoic acid (PubChem CID 122463166) has the molecular formula C7H17N3O4 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-[2-[2-(diaminoamino)ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-(diaminoamino)ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 122463166 |
| Molecular Formula | C7H17N3O4 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 3-[2-[2-(diaminoamino)ethoxy]ethoxy]propanoic acid |
| SMILES | NN(N)CCOCCOCCC(=O)O |
| InChI | InChI=1S/C7H17N3O4/c8-10(9)2-4-14-6-5-13-3-1-7(11)12/h1-6,8-9H2,(H,11,12) |
| InChIKey | SFGRAHWONVEGDL-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|