C8H24N6O3 — CID 143163312
N,N-diamino-2-[2-[2-[2-(diaminoamino)ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 143163312) has the molecular formula C8H24N6O3 and a molecular weight of 252.32 g/mol. Its IUPAC name is N,N-diamino-2-[2-[2-[2-(diaminoamino)ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | N,N-diamino-2-[2-[2-[2-(diaminoamino)ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 143163312 |
| Molecular Formula | C8H24N6O3 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | N,N-diamino-2-[2-[2-[2-(diaminoamino)ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | NN(N)CCOCCOCCOCCN(N)N |
| InChI | InChI=1S/C8H24N6O3/c9-13(10)1-3-15-5-7-17-8-6-16-4-2-14(11)12/h1-12H2 |
| InChIKey | GXSAHJAJRVYRBY-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|