C10H24N2O3 — CID 104561076
N'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N'-methylethane-1,2-diamine (PubChem CID 104561076) has the molecular formula C10H24N2O3 and a molecular weight of 220.31 g/mol. Its IUPAC name is N'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 104561076 |
| Molecular Formula | C10H24N2O3 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | N'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-N'-methylethane-1,2-diamine |
| SMILES | COCCOCCOCCN(C)CCN |
| InChI | InChI=1S/C10H24N2O3/c1-12(4-3-11)5-6-14-9-10-15-8-7-13-2/h3-11H2,1-2H3 |
| InChIKey | RIDBKVLLYMFPGV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|