C13H29NO6 — CID 87642085
1-[2-(2-methoxyethoxy)ethoxy]-N-[2-(2-methoxyethoxy)ethoxymethyl]-N-methylmethanamine (PubChem CID 87642085) has the molecular formula C13H29NO6 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)ethoxy]-N-[2-(2-methoxyethoxy)ethoxymethyl]-N-methylmethanamine.
| Compound Name | 1-[2-(2-methoxyethoxy)ethoxy]-N-[2-(2-methoxyethoxy)ethoxymethyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 87642085 |
| Molecular Formula | C13H29NO6 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)ethoxy]-N-[2-(2-methoxyethoxy)ethoxymethyl]-N-methylmethanamine |
| SMILES | COCCOCCOCN(C)COCCOCCOC |
| InChI | InChI=1S/C13H29NO6/c1-14(12-19-10-8-17-6-4-15-2)13-20-11-9-18-7-5-16-3/h4-13H2,1-3H3 |
| InChIKey | DGXDVIGBFLWULJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|