C9H21NO4 — CID 87640725
1-(2-methoxyethoxy)-N-(2-methoxyethoxymethyl)-N-methylmethanamine (PubChem CID 87640725) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-N-(2-methoxyethoxymethyl)-N-methylmethanamine.
| Compound Name | 1-(2-methoxyethoxy)-N-(2-methoxyethoxymethyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 87640725 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-(2-methoxyethoxy)-N-(2-methoxyethoxymethyl)-N-methylmethanamine |
| SMILES | COCCOCN(C)COCCOC |
| InChI | InChI=1S/C9H21NO4/c1-10(8-13-6-4-11-2)9-14-7-5-12-3/h4-9H2,1-3H3 |
| InChIKey | IQFNMJVDNPIRFU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|