C6H15NO2 — CID 87415200
1-(2-methoxyethoxy)-N,N-dimethylmethanamine (PubChem CID 87415200) has the molecular formula C6H15NO2 and a molecular weight of 133.19 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-methoxyethoxy)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 87415200 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 1-(2-methoxyethoxy)-N,N-dimethylmethanamine |
| SMILES | COCCOCN(C)C |
| InChI | InChI=1S/C6H15NO2/c1-7(2)6-9-5-4-8-3/h4-6H2,1-3H3 |
| InChIKey | BCNGLIYISAXCPD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|