C9H20ClNO3 — CID 176891909
1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-N,N-dimethylmethanamine (PubChem CID 176891909) has the molecular formula C9H20ClNO3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 176891909 |
| Molecular Formula | C9H20ClNO3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-N,N-dimethylmethanamine |
| SMILES | CN(C)COCCOCCOCCCl |
| InChI | InChI=1S/C9H20ClNO3/c1-11(2)9-14-8-7-13-6-5-12-4-3-10/h3-9H2,1-2H3 |
| InChIKey | ANUGTRFYWLFOBD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|