C14H36N2O2 — CID 168987783
2-[2-[2-(dimethylamino)ethoxy]ethoxy]-N,N-dimethylethanamine;ethane (PubChem CID 168987783) has the molecular formula C14H36N2O2 and a molecular weight of 264.45 g/mol. Its IUPAC name is 2-[2-[2-(dimethylamino)ethoxy]ethoxy]-N,N-dimethylethanamine;ethane.
| Compound Name | 2-[2-[2-(dimethylamino)ethoxy]ethoxy]-N,N-dimethylethanamine;ethane |
|---|---|
| PubChem CID | 168987783 |
| Molecular Formula | C14H36N2O2 |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 2-[2-[2-(dimethylamino)ethoxy]ethoxy]-N,N-dimethylethanamine;ethane |
| SMILES | CC.CC.CN(C)CCOCCOCCN(C)C |
| InChI | InChI=1S/C10H24N2O2.2C2H6/c1-11(2)5-7-13-9-10-14-8-6-12(3)4;2*1-2/h5-10H2,1-4H3;2*1-2H3 |
| InChIKey | UTWQWJGAIQRHHY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|