About S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate
S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate (PubChem CID 146606124) has the molecular formula C9H19NO3S
and a molecular weight of 221.32 g/mol. Its IUPAC name is S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate.
Molecular Properties
| Compound Name | S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate |
| PubChem CID | 146606124 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate |
| SMILES | CSC(=O)COCCOCCN(C)C |
| InChI | InChI=1S/C9H19NO3S/c1-10(2)4-5-12-6-7-13-8-9(11)14-3/h4-8H2,1-3H3 |
| InChIKey | AGCFFVXTEUNDSD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate?
The IUPAC name of S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate (CID 146606124) is S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate.
What is the SMILES notation for S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate?
The canonical SMILES for S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate is CSC(=O)COCCOCCN(C)C.
What is the InChIKey of S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate?
The InChIKey is AGCFFVXTEUNDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3S/c1-10(2)4-5-12-6-7-13-8-9(11)14-3/h4-8H2,1-3H3.
What are the key properties of S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate?
S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate has a molecular weight of 221.32 g/mol, XLogP of 0.47, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethanethioate is sourced from PubChem (CID 146606124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).