C16H34N2O2 — CID 175987160
2-[2-(dimethylamino)ethoxy]-N,N-dipentylacetamide (PubChem CID 175987160) has the molecular formula C16H34N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-N,N-dipentylacetamide.
| Compound Name | 2-[2-(dimethylamino)ethoxy]-N,N-dipentylacetamide |
|---|---|
| PubChem CID | 175987160 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-N,N-dipentylacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)COCCN(C)C |
| InChI | InChI=1S/C16H34N2O2/c1-5-7-9-11-18(12-10-8-6-2)16(19)15-20-14-13-17(3)4/h5-15H2,1-4H3 |
| InChIKey | XEBRHWAIDNEOFR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|