C24H48N2O3 — CID 102105691
2-[2-(dipentylamino)-2-oxoethoxy]-N,N-dipentylacetamide (PubChem CID 102105691) has the molecular formula C24H48N2O3 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2-[2-(dipentylamino)-2-oxoethoxy]-N,N-dipentylacetamide.
| Compound Name | 2-[2-(dipentylamino)-2-oxoethoxy]-N,N-dipentylacetamide |
|---|---|
| PubChem CID | 102105691 |
| Molecular Formula | C24H48N2O3 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 2-[2-(dipentylamino)-2-oxoethoxy]-N,N-dipentylacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)COCC(=O)N(CCCCC)CCCCC |
| InChI | InChI=1S/C24H48N2O3/c1-5-9-13-17-25(18-14-10-6-2)23(27)21-29-22-24(28)26(19-15-11-7-3)20-16-12-8-4/h5-22H2,1-4H3 |
| InChIKey | HNFBDIODCWGCDE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|