C13H27NO2 — CID 60776145
2-methoxy-N,N-dipentylacetamide (PubChem CID 60776145) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-methoxy-N,N-dipentylacetamide.
| Compound Name | 2-methoxy-N,N-dipentylacetamide |
|---|---|
| PubChem CID | 60776145 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-methoxy-N,N-dipentylacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)COC |
| InChI | InChI=1S/C13H27NO2/c1-4-6-8-10-14(11-9-7-5-2)13(15)12-16-3/h4-12H2,1-3H3 |
| InChIKey | LXZCDLLRWRYEQZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|