C9H19NO3 — CID 20697100
N-butyl-N-(2-hydroxyethyl)-2-methoxyacetamide (PubChem CID 20697100) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is N-butyl-N-(2-hydroxyethyl)-2-methoxyacetamide.
| Compound Name | N-butyl-N-(2-hydroxyethyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 20697100 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-butyl-N-(2-hydroxyethyl)-2-methoxyacetamide |
| SMILES | CCCCN(CCO)C(=O)COC |
| InChI | InChI=1S/C9H19NO3/c1-3-4-5-10(6-7-11)9(12)8-13-2/h11H,3-8H2,1-2H3 |
| InChIKey | YVTLZZIAXCIJGS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |