C9H21NO4 — CID 145142021
N,N-bis(2-hydroxyethyl)-2-methoxyacetamide;ethane (PubChem CID 145142021) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-methoxyacetamide;ethane.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-methoxyacetamide;ethane |
|---|---|
| PubChem CID | 145142021 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-methoxyacetamide;ethane |
| SMILES | CC.COCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C7H15NO4.C2H6/c1-12-6-7(11)8(2-4-9)3-5-10;1-2/h9-10H,2-6H2,1H3;1-2H3 |
| InChIKey | BMQYKLJRCLCMST-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |