C8H17NO3 — CID 14455174
N,N-bis(2-hydroxyethyl)butanamide (PubChem CID 14455174) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)butanamide.
| Compound Name | N,N-bis(2-hydroxyethyl)butanamide |
|---|---|
| PubChem CID | 14455174 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)butanamide |
| SMILES | CCCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C8H17NO3/c1-2-3-8(12)9(4-6-10)5-7-11/h10-11H,2-7H2,1H3 |
| InChIKey | FZALBMZJCBBKRI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |