C13H32N2O3 — CID 168940710
3-(dimethylamino)-N,N-bis(2-hydroxyethyl)propanamide;ethane (PubChem CID 168940710) has the molecular formula C13H32N2O3 and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-(dimethylamino)-N,N-bis(2-hydroxyethyl)propanamide;ethane.
| Compound Name | 3-(dimethylamino)-N,N-bis(2-hydroxyethyl)propanamide;ethane |
|---|---|
| PubChem CID | 168940710 |
| Molecular Formula | C13H32N2O3 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.24 |
| IUPAC Name | 3-(dimethylamino)-N,N-bis(2-hydroxyethyl)propanamide;ethane |
| SMILES | CC.CC.CN(C)CCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H20N2O3.2C2H6/c1-10(2)4-3-9(14)11(5-7-12)6-8-13;2*1-2/h12-13H,3-8H2,1-2H3;2*1-2H3 |
| InChIKey | QPRKKETXGWXNLM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |